C20H20N4O2S3 — CID 16576692
2-[4-[[5-(2-thiophen-2-ylethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]butyl]isoindole-1,3-dione (PubChem CID 16576692) has the molecular formula C20H20N4O2S3 and a molecular weight of 444.61 g/mol. Its IUPAC name is 2-[4-[[5-(2-thiophen-2-ylethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]butyl]isoindole-1,3-dione.
| Compound Name | 2-[4-[[5-(2-thiophen-2-ylethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]butyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 16576692 |
| Molecular Formula | C20H20N4O2S3 |
| Molecular Weight | 444.61 g/mol |
| Exact Mass | 444.07 |
| IUPAC Name | 2-[4-[[5-(2-thiophen-2-ylethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]butyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCCCSc1nnc(NCCc2cccs2)s1 |
| InChI | InChI=1S/C20H20N4O2S3/c25-17-15-7-1-2-8-16(15)18(26)24(17)11-3-4-12-28-20-23-22-19(29-20)21-10-9-14-6-5-13-27-14/h1-2,5-8,13H,3-4,9-12H2,(H,21,22) |
| InChIKey | PGVAGRMBQXVAFU-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.61 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|