C10H16N4S2 — CID 30932144
4-[[5-(2-methylpropylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]butanenitrile (PubChem CID 30932144) has the molecular formula C10H16N4S2 and a molecular weight of 256.40 g/mol. Its IUPAC name is 4-[[5-(2-methylpropylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]butanenitrile.
| Compound Name | 4-[[5-(2-methylpropylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]butanenitrile |
|---|---|
| PubChem CID | 30932144 |
| Molecular Formula | C10H16N4S2 |
| Molecular Weight | 256.40 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 4-[[5-(2-methylpropylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]butanenitrile |
| SMILES | CC(C)CNc1nnc(SCCCC#N)s1 |
| InChI | InChI=1S/C10H16N4S2/c1-8(2)7-12-9-13-14-10(16-9)15-6-4-3-5-11/h8H,3-4,6-7H2,1-2H3,(H,12,13) |
| InChIKey | LIKFKCVYYNETQX-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.40 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|