C14H16F3N3O2S2 — CID 60613869
5-[[5-[4-(trifluoromethoxy)anilino]-1,3,4-thiadiazol-2-yl]sulfanyl]pentan-1-ol (PubChem CID 60613869) has the molecular formula C14H16F3N3O2S2 and a molecular weight of 379.43 g/mol. Its IUPAC name is 5-[[5-[4-(trifluoromethoxy)anilino]-1,3,4-thiadiazol-2-yl]sulfanyl]pentan-1-ol.
| Compound Name | 5-[[5-[4-(trifluoromethoxy)anilino]-1,3,4-thiadiazol-2-yl]sulfanyl]pentan-1-ol |
|---|---|
| PubChem CID | 60613869 |
| Molecular Formula | C14H16F3N3O2S2 |
| Molecular Weight | 379.43 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | 5-[[5-[4-(trifluoromethoxy)anilino]-1,3,4-thiadiazol-2-yl]sulfanyl]pentan-1-ol |
| SMILES | OCCCCCSc1nnc(Nc2ccc(OC(F)(F)F)cc2)s1 |
| InChI | InChI=1S/C14H16F3N3O2S2/c15-14(16,17)22-11-6-4-10(5-7-11)18-12-19-20-13(24-12)23-9-3-1-2-8-21/h4-7,21H,1-3,8-9H2,(H,18,19) |
| InChIKey | NBSGYWDFQPAYPS-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.43 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|