C19H14F3N5O2S2 — CID 30084938
N-(cyanomethyl)-N-phenyl-2-[[5-[4-(trifluoromethoxy)anilino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide (PubChem CID 30084938) has the molecular formula C19H14F3N5O2S2 and a molecular weight of 465.48 g/mol. Its IUPAC name is N-(cyanomethyl)-N-phenyl-2-[[5-[4-(trifluoromethoxy)anilino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide.
| Compound Name | N-(cyanomethyl)-N-phenyl-2-[[5-[4-(trifluoromethoxy)anilino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 30084938 |
| Molecular Formula | C19H14F3N5O2S2 |
| Molecular Weight | 465.48 g/mol |
| Exact Mass | 465.05 |
| IUPAC Name | N-(cyanomethyl)-N-phenyl-2-[[5-[4-(trifluoromethoxy)anilino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
| SMILES | N#CCN(C(=O)CSc1nnc(Nc2ccc(OC(F)(F)F)cc2)s1)c1ccccc1 |
| InChI | InChI=1S/C19H14F3N5O2S2/c20-19(21,22)29-15-8-6-13(7-9-15)24-17-25-26-18(31-17)30-12-16(28)27(11-10-23)14-4-2-1-3-5-14/h1-9H,11-12H2,(H,24,25) |
| InChIKey | GZJKTXOOUXTXLT-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 91.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.48 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|