C9H17N3S3 — CID 106808519
6-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]hexan-3-amine (PubChem CID 106808519) has the molecular formula C9H17N3S3 and a molecular weight of 263.46 g/mol. Its IUPAC name is 6-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]hexan-3-amine.
| Compound Name | 6-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]hexan-3-amine |
|---|---|
| PubChem CID | 106808519 |
| Molecular Formula | C9H17N3S3 |
| Molecular Weight | 263.46 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | 6-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]hexan-3-amine |
| SMILES | CCC(N)CCCSc1nnc(SC)s1 |
| InChI | InChI=1S/C9H17N3S3/c1-3-7(10)5-4-6-14-9-12-11-8(13-2)15-9/h7H,3-6,10H2,1-2H3 |
| InChIKey | LIFIBDPOHGOCBR-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.46 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|