C9H18N4S — CID 106808273
6-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]hexan-3-amine (PubChem CID 106808273) has the molecular formula C9H18N4S and a molecular weight of 214.34 g/mol. Its IUPAC name is 6-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]hexan-3-amine.
| Compound Name | 6-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]hexan-3-amine |
|---|---|
| PubChem CID | 106808273 |
| Molecular Formula | C9H18N4S |
| Molecular Weight | 214.34 g/mol |
| Exact Mass | 214.13 |
| IUPAC Name | 6-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]hexan-3-amine |
| SMILES | CCC(N)CCCSc1nncn1C |
| InChI | InChI=1S/C9H18N4S/c1-3-8(10)5-4-6-14-9-12-11-7-13(9)2/h7-8H,3-6,10H2,1-2H3 |
| InChIKey | ASSZMJIIQKRQBS-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.34 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|