About 6-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]hexan-3-amine
6-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]hexan-3-amine (PubChem CID 106808273) has the molecular formula C9H18N4S
and a molecular weight of 214.34 g/mol. Its IUPAC name is 6-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]hexan-3-amine.
Molecular Properties
| Compound Name | 6-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]hexan-3-amine |
| PubChem CID | 106808273 |
| Molecular Formula | C9H18N4S |
| Molecular Weight | 214.34 g/mol |
| Exact Mass | 214.13 |
| IUPAC Name | 6-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]hexan-3-amine |
| SMILES | CCC(N)CCCSc1nncn1C |
| InChI | InChI=1S/C9H18N4S/c1-3-8(10)5-4-6-14-9-12-11-7-13(9)2/h7-8H,3-6,10H2,1-2H3 |
| InChIKey | ASSZMJIIQKRQBS-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.34 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]hexan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]hexan-3-amine?
The IUPAC name of 6-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]hexan-3-amine (CID 106808273) is 6-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]hexan-3-amine.
What is the SMILES notation for 6-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]hexan-3-amine?
The canonical SMILES for 6-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]hexan-3-amine is CCC(N)CCCSc1nncn1C.
What is the InChIKey of 6-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]hexan-3-amine?
The InChIKey is ASSZMJIIQKRQBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N4S/c1-3-8(10)5-4-6-14-9-12-11-7-13(9)2/h7-8H,3-6,10H2,1-2H3.
What are the key properties of 6-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]hexan-3-amine?
6-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]hexan-3-amine has a molecular weight of 214.34 g/mol, XLogP of 1.42, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]hexan-3-amine is sourced from PubChem (CID 106808273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).