C9H16N4OS2 — CID 2747629
N'-(5-hexylsulfanyl-1,3,4-thiadiazol-2-yl)-N-hydroxymethanimidamide (PubChem CID 2747629) has the molecular formula C9H16N4OS2 and a molecular weight of 260.39 g/mol. Its IUPAC name is N'-(5-hexylsulfanyl-1,3,4-thiadiazol-2-yl)-N-hydroxymethanimidamide.
| Compound Name | N'-(5-hexylsulfanyl-1,3,4-thiadiazol-2-yl)-N-hydroxymethanimidamide |
|---|---|
| PubChem CID | 2747629 |
| Molecular Formula | C9H16N4OS2 |
| Molecular Weight | 260.39 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | N'-(5-hexylsulfanyl-1,3,4-thiadiazol-2-yl)-N-hydroxymethanimidamide |
| SMILES | CCCCCCSc1nnc(N=CNO)s1 |
| InChI | InChI=1S/C9H16N4OS2/c1-2-3-4-5-6-15-9-13-12-8(16-9)10-7-11-14/h7,14H,2-6H2,1H3,(H,10,11,12) |
| InChIKey | KUQQNJSDPFSILG-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 70.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.39 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|