C6H10N4OS2 — CID 2747628
N-hydroxy-N'-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)methanimidamide (PubChem CID 2747628) has the molecular formula C6H10N4OS2 and a molecular weight of 218.31 g/mol. Its IUPAC name is N-hydroxy-N'-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)methanimidamide.
| Compound Name | N-hydroxy-N'-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)methanimidamide |
|---|---|
| PubChem CID | 2747628 |
| Molecular Formula | C6H10N4OS2 |
| Molecular Weight | 218.31 g/mol |
| Exact Mass | 218.03 |
| IUPAC Name | N-hydroxy-N'-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)methanimidamide |
| SMILES | CCCSc1nnc(N=CNO)s1 |
| InChI | InChI=1S/C6H10N4OS2/c1-2-3-12-6-10-9-5(13-6)7-4-8-11/h4,11H,2-3H2,1H3,(H,7,8,9) |
| InChIKey | GPQASGCAMKADMQ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 70.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.31 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|