C7H15N3S2 — CID 142119097
ethane;5-propylsulfanyl-1,3,4-thiadiazol-2-amine (PubChem CID 142119097) has the molecular formula C7H15N3S2 and a molecular weight of 205.35 g/mol. Its IUPAC name is ethane;5-propylsulfanyl-1,3,4-thiadiazol-2-amine.
| Compound Name | ethane;5-propylsulfanyl-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 142119097 |
| Molecular Formula | C7H15N3S2 |
| Molecular Weight | 205.35 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | ethane;5-propylsulfanyl-1,3,4-thiadiazol-2-amine |
| SMILES | CC.CCCSc1nnc(N)s1 |
| InChI | InChI=1S/C5H9N3S2.C2H6/c1-2-3-9-5-8-7-4(6)10-5;1-2/h2-3H2,1H3,(H2,6,7);1-2H3 |
| InChIKey | FNWOWYJWBOUGQT-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.35 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |