C6H11N3O2S2 — CID 61071093
2-[2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]ethoxy]ethanol (PubChem CID 61071093) has the molecular formula C6H11N3O2S2 and a molecular weight of 221.31 g/mol. Its IUPAC name is 2-[2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]ethoxy]ethanol.
| Compound Name | 2-[2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]ethoxy]ethanol |
|---|---|
| PubChem CID | 61071093 |
| Molecular Formula | C6H11N3O2S2 |
| Molecular Weight | 221.31 g/mol |
| Exact Mass | 221.03 |
| IUPAC Name | 2-[2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]ethoxy]ethanol |
| SMILES | Nc1nnc(SCCOCCO)s1 |
| InChI | InChI=1S/C6H11N3O2S2/c7-5-8-9-6(13-5)12-4-3-11-2-1-10/h10H,1-4H2,(H2,7,8) |
| InChIKey | GHOWIOINTWITNS-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 81.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.31 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|