C14H24N4O3S2 — CID 70619872
1-(5-hexylsulfanyl-1,3,4-thiadiazol-2-yl)-5-hydroxy-4-(methoxymethyl)-3-methylimidazolidin-2-one (PubChem CID 70619872) has the molecular formula C14H24N4O3S2 and a molecular weight of 360.51 g/mol. Its IUPAC name is 1-(5-hexylsulfanyl-1,3,4-thiadiazol-2-yl)-5-hydroxy-4-(methoxymethyl)-3-methylimidazolidin-2-one.
| Compound Name | 1-(5-hexylsulfanyl-1,3,4-thiadiazol-2-yl)-5-hydroxy-4-(methoxymethyl)-3-methylimidazolidin-2-one |
|---|---|
| PubChem CID | 70619872 |
| Molecular Formula | C14H24N4O3S2 |
| Molecular Weight | 360.51 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | 1-(5-hexylsulfanyl-1,3,4-thiadiazol-2-yl)-5-hydroxy-4-(methoxymethyl)-3-methylimidazolidin-2-one |
| SMILES | CCCCCCSc1nnc(N2C(=O)N(C)C(COC)C2O)s1 |
| InChI | InChI=1S/C14H24N4O3S2/c1-4-5-6-7-8-22-13-16-15-12(23-13)18-11(19)10(9-21-3)17(2)14(18)20/h10-11,19H,4-9H2,1-3H3 |
| InChIKey | SVBHFKKDQJVIKR-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.51 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|