C25H37N5O3S2 — CID 21404034
[1-methyl-2-oxo-3-(5-pentylsulfanyl-1,3,4-thiadiazol-2-yl)-1,3-diazinan-4-yl] N-(4-hexylphenyl)carbamate (PubChem CID 21404034) has the molecular formula C25H37N5O3S2 and a molecular weight of 519.74 g/mol. Its IUPAC name is [1-methyl-2-oxo-3-(5-pentylsulfanyl-1,3,4-thiadiazol-2-yl)-1,3-diazinan-4-yl] N-(4-hexylphenyl)carbamate.
| Compound Name | [1-methyl-2-oxo-3-(5-pentylsulfanyl-1,3,4-thiadiazol-2-yl)-1,3-diazinan-4-yl] N-(4-hexylphenyl)carbamate |
|---|---|
| PubChem CID | 21404034 |
| Molecular Formula | C25H37N5O3S2 |
| Molecular Weight | 519.74 g/mol |
| Exact Mass | 519.23 |
| IUPAC Name | [1-methyl-2-oxo-3-(5-pentylsulfanyl-1,3,4-thiadiazol-2-yl)-1,3-diazinan-4-yl] N-(4-hexylphenyl)carbamate |
| SMILES | CCCCCCc1ccc(NC(=O)OC2CCN(C)C(=O)N2c2nnc(SCCCCC)s2)cc1 |
| InChI | InChI=1S/C25H37N5O3S2/c1-4-6-8-9-11-19-12-14-20(15-13-19)26-23(31)33-21-16-17-29(3)25(32)30(21)22-27-28-24(35-22)34-18-10-7-5-2/h12-15,21H,4-11,16-18H2,1-3H3,(H,26,31) |
| InChIKey | ZSGJAUIVCVTHQH-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.74 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|