C17H30N4O2S2 — CID 21400119
1-hexyl-4-hydroxy-3-(5-pentylsulfanyl-1,3,4-thiadiazol-2-yl)-1,3-diazinan-2-one (PubChem CID 21400119) has the molecular formula C17H30N4O2S2 and a molecular weight of 386.59 g/mol. Its IUPAC name is 1-hexyl-4-hydroxy-3-(5-pentylsulfanyl-1,3,4-thiadiazol-2-yl)-1,3-diazinan-2-one.
| Compound Name | 1-hexyl-4-hydroxy-3-(5-pentylsulfanyl-1,3,4-thiadiazol-2-yl)-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 21400119 |
| Molecular Formula | C17H30N4O2S2 |
| Molecular Weight | 386.59 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | 1-hexyl-4-hydroxy-3-(5-pentylsulfanyl-1,3,4-thiadiazol-2-yl)-1,3-diazinan-2-one |
| SMILES | CCCCCCN1CCC(O)N(c2nnc(SCCCCC)s2)C1=O |
| InChI | InChI=1S/C17H30N4O2S2/c1-3-5-7-8-11-20-12-10-14(22)21(17(20)23)15-18-19-16(25-15)24-13-9-6-4-2/h14,22H,3-13H2,1-2H3 |
| InChIKey | QWJACBGRQJIKJE-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.59 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|