C23H40N4O4S — CID 21418621
[3-(5-hexyl-1,3,4-thiadiazol-2-yl)-2-oxo-1-pentyl-1,3-diazinan-4-yl] pentyl carbonate (PubChem CID 21418621) has the molecular formula C23H40N4O4S and a molecular weight of 468.66 g/mol. Its IUPAC name is [3-(5-hexyl-1,3,4-thiadiazol-2-yl)-2-oxo-1-pentyl-1,3-diazinan-4-yl] pentyl carbonate.
| Compound Name | [3-(5-hexyl-1,3,4-thiadiazol-2-yl)-2-oxo-1-pentyl-1,3-diazinan-4-yl] pentyl carbonate |
|---|---|
| PubChem CID | 21418621 |
| Molecular Formula | C23H40N4O4S |
| Molecular Weight | 468.66 g/mol |
| Exact Mass | 468.28 |
| IUPAC Name | [3-(5-hexyl-1,3,4-thiadiazol-2-yl)-2-oxo-1-pentyl-1,3-diazinan-4-yl] pentyl carbonate |
| SMILES | CCCCCCc1nnc(N2C(=O)N(CCCCC)CCC2OC(=O)OCCCCC)s1 |
| InChI | InChI=1S/C23H40N4O4S/c1-4-7-10-11-14-19-24-25-21(32-19)27-20(31-23(29)30-18-13-9-6-3)15-17-26(22(27)28)16-12-8-5-2/h20H,4-18H2,1-3H3 |
| InChIKey | WROOSICOEHZHFR-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 84.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.66 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|