C20H30N4O3S — CID 21481915
[3-(5-cyclobutyl-1,3,4-thiadiazol-2-yl)-2-oxo-1-[(E)-pent-3-enyl]-1,3-diazinan-4-yl] pentanoate (PubChem CID 21481915) has the molecular formula C20H30N4O3S and a molecular weight of 406.55 g/mol. Its IUPAC name is [3-(5-cyclobutyl-1,3,4-thiadiazol-2-yl)-2-oxo-1-[(E)-pent-3-enyl]-1,3-diazinan-4-yl] pentanoate.
| Compound Name | [3-(5-cyclobutyl-1,3,4-thiadiazol-2-yl)-2-oxo-1-[(E)-pent-3-enyl]-1,3-diazinan-4-yl] pentanoate |
|---|---|
| PubChem CID | 21481915 |
| Molecular Formula | C20H30N4O3S |
| Molecular Weight | 406.55 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | [3-(5-cyclobutyl-1,3,4-thiadiazol-2-yl)-2-oxo-1-[(E)-pent-3-enyl]-1,3-diazinan-4-yl] pentanoate |
| SMILES | C/C=C/CCN1CCC(OC(=O)CCCC)N(c2nnc(C3CCC3)s2)C1=O |
| InChI | InChI=1S/C20H30N4O3S/c1-3-5-7-13-23-14-12-16(27-17(25)11-6-4-2)24(20(23)26)19-22-21-18(28-19)15-9-8-10-15/h3,5,15-16H,4,6-14H2,1-2H3/b5-3+ |
| InChIKey | RGXNBOKJCSTYGA-HWKANZROSA-N |
| XLogP | 4.46 |
| TPSA | 75.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.55 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|