C14H21NO7 — CID 22178419
(1-hydroxy-2,5-dioxo-4-pentanoyloxypyrrolidin-3-yl) pentanoate (PubChem CID 22178419) has the molecular formula C14H21NO7 and a molecular weight of 315.32 g/mol. Its IUPAC name is (1-hydroxy-2,5-dioxo-4-pentanoyloxypyrrolidin-3-yl) pentanoate.
| Compound Name | (1-hydroxy-2,5-dioxo-4-pentanoyloxypyrrolidin-3-yl) pentanoate |
|---|---|
| PubChem CID | 22178419 |
| Molecular Formula | C14H21NO7 |
| Molecular Weight | 315.32 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | (1-hydroxy-2,5-dioxo-4-pentanoyloxypyrrolidin-3-yl) pentanoate |
| SMILES | CCCCC(=O)OC1C(=O)N(O)C(=O)C1OC(=O)CCCC |
| InChI | InChI=1S/C14H21NO7/c1-3-5-7-9(16)21-11-12(14(19)15(20)13(11)18)22-10(17)8-6-4-2/h11-12,20H,3-8H2,1-2H3 |
| InChIKey | CHWLCJCLXBGJKS-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.32 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|