C15H21NO6 — CID 156841489
(6-methoxy-2-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-5-yl) pentanoate (PubChem CID 156841489) has the molecular formula C15H21NO6 and a molecular weight of 311.33 g/mol. Its IUPAC name is (6-methoxy-2-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-5-yl) pentanoate.
| Compound Name | (6-methoxy-2-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-5-yl) pentanoate |
|---|---|
| PubChem CID | 156841489 |
| Molecular Formula | C15H21NO6 |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | (6-methoxy-2-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-5-yl) pentanoate |
| SMILES | CCCCC(=O)OC1C(OC)C2OC1C1C(=O)N(C)C(=O)C21 |
| InChI | InChI=1S/C15H21NO6/c1-4-5-6-7(17)21-13-11-9-8(10(22-11)12(13)20-3)14(18)16(2)15(9)19/h8-13H,4-6H2,1-3H3 |
| InChIKey | NWWNYTWJTTTZRX-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|