C26H43N3O7 — CID 58756499
[(3R,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-methoxy-3-octanoyloxyoxolan-2-yl]methyl octanoate (PubChem CID 58756499) has the molecular formula C26H43N3O7 and a molecular weight of 509.64 g/mol. Its IUPAC name is [(3R,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-methoxy-3-octanoyloxyoxolan-2-yl]methyl octanoate.
| Compound Name | [(3R,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-methoxy-3-octanoyloxyoxolan-2-yl]methyl octanoate |
|---|---|
| PubChem CID | 58756499 |
| Molecular Formula | C26H43N3O7 |
| Molecular Weight | 509.64 g/mol |
| Exact Mass | 509.31 |
| IUPAC Name | [(3R,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-methoxy-3-octanoyloxyoxolan-2-yl]methyl octanoate |
| SMILES | CCCCCCCC(=O)OCC1O[C@@H](n2ccc(N)nc2=O)[C@H](OC)[C@@H]1OC(=O)CCCCCCC |
| InChI | InChI=1S/C26H43N3O7/c1-4-6-8-10-12-14-21(30)34-18-19-23(36-22(31)15-13-11-9-7-5-2)24(33-3)25(35-19)29-17-16-20(27)28-26(29)32/h16-17,19,23-25H,4-15,18H2,1-3H3,(H2,27,28,32)/t19?,23-,24-,25-/m1/s1 |
| InChIKey | PWSVEKMFBCPTAA-KIZJSLQPSA-N |
| XLogP | 3.91 |
| TPSA | 131.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.64 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|