C21H31N3O8 — CID 70858565
[(3R,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-bis(2-methylpropanoyloxy)oxolan-2-yl]methyl 2-methylpropanoate (PubChem CID 70858565) has the molecular formula C21H31N3O8 and a molecular weight of 453.49 g/mol. Its IUPAC name is [(3R,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-bis(2-methylpropanoyloxy)oxolan-2-yl]methyl 2-methylpropanoate.
| Compound Name | [(3R,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-bis(2-methylpropanoyloxy)oxolan-2-yl]methyl 2-methylpropanoate |
|---|---|
| PubChem CID | 70858565 |
| Molecular Formula | C21H31N3O8 |
| Molecular Weight | 453.49 g/mol |
| Exact Mass | 453.21 |
| IUPAC Name | [(3R,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-bis(2-methylpropanoyloxy)oxolan-2-yl]methyl 2-methylpropanoate |
| SMILES | CC(C)C(=O)OCC1O[C@@H](n2ccc(N)nc2=O)[C@H](OC(=O)C(C)C)[C@@H]1OC(=O)C(C)C |
| InChI | InChI=1S/C21H31N3O8/c1-10(2)18(25)29-9-13-15(31-19(26)11(3)4)16(32-20(27)12(5)6)17(30-13)24-8-7-14(22)23-21(24)28/h7-8,10-13,15-17H,9H2,1-6H3,(H2,22,23,28)/t13?,15-,16-,17-/m1/s1 |
| InChIKey | LXVIIZSREYEJFA-SDAGNLPFSA-N |
| XLogP | 1.06 |
| TPSA | 149.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.49 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|