C17H27N3O9P- — CID 176874019
[(2R,4S,5R)-4-acetyloxy-5-(4-amino-2-oxopyrimidin-1-yl)-3-propan-2-yloxyoxolan-2-yl]methyl propan-2-yl phosphate (PubChem CID 176874019) has the molecular formula C17H27N3O9P- and a molecular weight of 448.39 g/mol. Its IUPAC name is [(2R,4S,5R)-4-acetyloxy-5-(4-amino-2-oxopyrimidin-1-yl)-3-propan-2-yloxyoxolan-2-yl]methyl propan-2-yl phosphate.
| Compound Name | [(2R,4S,5R)-4-acetyloxy-5-(4-amino-2-oxopyrimidin-1-yl)-3-propan-2-yloxyoxolan-2-yl]methyl propan-2-yl phosphate |
|---|---|
| PubChem CID | 176874019 |
| Molecular Formula | C17H27N3O9P- |
| Molecular Weight | 448.39 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | [(2R,4S,5R)-4-acetyloxy-5-(4-amino-2-oxopyrimidin-1-yl)-3-propan-2-yloxyoxolan-2-yl]methyl propan-2-yl phosphate |
| SMILES | CC(=O)O[C@H]1C(OC(C)C)[C@@H](COP(=O)([O-])OC(C)C)O[C@H]1n1ccc(N)nc1=O |
| InChI | InChI=1S/C17H28N3O9P/c1-9(2)26-14-12(8-25-30(23,24)29-10(3)4)28-16(15(14)27-11(5)21)20-7-6-13(18)19-17(20)22/h6-7,9-10,12,14-16H,8H2,1-5H3,(H,23,24)(H2,18,19,22)/p-1/t12-,14?,15+,16-/m1/s1 |
| InChIKey | CSICNGXIVNESJE-QSBXLFSZSA-M |
| XLogP | 0.36 |
| TPSA | 164.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.39 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|