C12H20N3O9P — CID 122480562
[(2R,3R,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3-hydroxy-4-(1-methoxyethoxy)oxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 122480562) has the molecular formula C12H20N3O9P and a molecular weight of 381.28 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3-hydroxy-4-(1-methoxyethoxy)oxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,3R,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3-hydroxy-4-(1-methoxyethoxy)oxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 122480562 |
| Molecular Formula | C12H20N3O9P |
| Molecular Weight | 381.28 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | [(2R,3R,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3-hydroxy-4-(1-methoxyethoxy)oxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | COC(C)O[C@@H]1[C@H](O)[C@@H](COP(=O)(O)O)O[C@H]1n1ccc(N)nc1=O |
| InChI | InChI=1S/C12H20N3O9P/c1-6(21-2)23-10-9(16)7(5-22-25(18,19)20)24-11(10)15-4-3-8(13)14-12(15)17/h3-4,6-7,9-11,16H,5H2,1-2H3,(H2,13,14,17)(H2,18,19,20)/t6?,7-,9-,10-,11-/m1/s1 |
| InChIKey | BVQIQEHJBYCUDJ-JANFQQFMSA-N |
| XLogP | -1.43 |
| TPSA | 175.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.28 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|