C15H26N3O7P — CID 176953361
[5-(4-amino-2-oxopyrimidin-1-yl)-4-methoxy-3-propan-2-yloxyoxolan-2-yl]methoxy-ethylphosphinic acid (PubChem CID 176953361) has the molecular formula C15H26N3O7P and a molecular weight of 391.36 g/mol. Its IUPAC name is [5-(4-amino-2-oxopyrimidin-1-yl)-4-methoxy-3-propan-2-yloxyoxolan-2-yl]methoxy-ethylphosphinic acid.
| Compound Name | [5-(4-amino-2-oxopyrimidin-1-yl)-4-methoxy-3-propan-2-yloxyoxolan-2-yl]methoxy-ethylphosphinic acid |
|---|---|
| PubChem CID | 176953361 |
| Molecular Formula | C15H26N3O7P |
| Molecular Weight | 391.36 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | [5-(4-amino-2-oxopyrimidin-1-yl)-4-methoxy-3-propan-2-yloxyoxolan-2-yl]methoxy-ethylphosphinic acid |
| SMILES | CCP(=O)(O)OCC1OC(n2ccc(N)nc2=O)C(OC)C1OC(C)C |
| InChI | InChI=1S/C15H26N3O7P/c1-5-26(20,21)23-8-10-12(24-9(2)3)13(22-4)14(25-10)18-7-6-11(16)17-15(18)19/h6-7,9-10,12-14H,5,8H2,1-4H3,(H,20,21)(H2,16,17,19) |
| InChIKey | VRLQMFKOIGNXJH-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 135.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.36 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|