C19H28N6O15P2 — CID 162861933
[(2R,3R,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-(hydroxymethyl)-4-methoxyoxolan-3-yl] [(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-hydroxy-3-phosphonooxyoxolan-2-yl]methyl hydrogen phosphate (PubChem CID 162861933) has the molecular formula C19H28N6O15P2 and a molecular weight of 642.41 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-(hydroxymethyl)-4-methoxyoxolan-3-yl] [(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-hydroxy-3-phosphonooxyoxolan-2-yl]methyl hydrogen phosphate.
| Compound Name | [(2R,3R,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-(hydroxymethyl)-4-methoxyoxolan-3-yl] [(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-hydroxy-3-phosphonooxyoxolan-2-yl]methyl hydrogen phosphate |
|---|---|
| PubChem CID | 162861933 |
| Molecular Formula | C19H28N6O15P2 |
| Molecular Weight | 642.41 g/mol |
| Exact Mass | 642.11 |
| IUPAC Name | [(2R,3R,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-(hydroxymethyl)-4-methoxyoxolan-3-yl] [(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-hydroxy-3-phosphonooxyoxolan-2-yl]methyl hydrogen phosphate |
| SMILES | CO[C@@H]1[C@H](OP(=O)(O)OC[C@H]2O[C@@H](n3ccc(N)nc3=O)[C@H](O)[C@@H]2OP(=O)(O)O)[C@@H](CO)O[C@H]1n1ccc(N)nc1=O |
| InChI | InChI=1S/C19H28N6O15P2/c1-35-15-14(8(6-26)37-17(15)25-5-3-11(21)23-19(25)29)40-42(33,34)36-7-9-13(39-41(30,31)32)12(27)16(38-9)24-4-2-10(20)22-18(24)28/h2-5,8-9,12-17,26-27H,6-7H2,1H3,(H,33,34)(H2,20,22,28)(H2,21,23,29)(H2,30,31,32)/t8-,9-,12-,13-,14-,15-,16-,17-/m1/s1 |
| InChIKey | HJCJPBBVOQLDFO-RTGFKBDUSA-N |
| XLogP | -3.19 |
| TPSA | 312.49 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.41 |
| LogP ≤ 5 | -3.19 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|