C9H14N3O10P — CID 87389348
[(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-hydroxy-2-(trioxidanylmethyl)oxolan-3-yl] dihydrogen phosphate (PubChem CID 87389348) has the molecular formula C9H14N3O10P and a molecular weight of 355.20 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-hydroxy-2-(trioxidanylmethyl)oxolan-3-yl] dihydrogen phosphate.
| Compound Name | [(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-hydroxy-2-(trioxidanylmethyl)oxolan-3-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 87389348 |
| Molecular Formula | C9H14N3O10P |
| Molecular Weight | 355.20 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-hydroxy-2-(trioxidanylmethyl)oxolan-3-yl] dihydrogen phosphate |
| SMILES | Nc1ccn([C@@H]2O[C@H](COOO)[C@@H](OP(=O)(O)O)[C@H]2O)c(=O)n1 |
| InChI | InChI=1S/C9H14N3O10P/c10-5-1-2-12(9(14)11-5)8-6(13)7(21-23(16,17)18)4(20-8)3-19-22-15/h1-2,4,6-8,13,15H,3H2,(H2,10,11,14)(H2,16,17,18)/t4-,6-,7-,8-/m1/s1 |
| InChIKey | JFWXOZTXFFYFSY-XVFCMESISA-N |
| XLogP | -2.02 |
| TPSA | 195.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.20 |
| LogP ≤ 5 | -2.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|