C20H28N5O12P — CID 102395866
[(2R,3R,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-(hydroxymethyl)-4-methoxyoxolan-3-yl] [(2R,3S,5R)-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl hydrogen phosphate (PubChem CID 102395866) has the molecular formula C20H28N5O12P and a molecular weight of 561.44 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-(hydroxymethyl)-4-methoxyoxolan-3-yl] [(2R,3S,5R)-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl hydrogen phosphate.
| Compound Name | [(2R,3R,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-(hydroxymethyl)-4-methoxyoxolan-3-yl] [(2R,3S,5R)-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl hydrogen phosphate |
|---|---|
| PubChem CID | 102395866 |
| Molecular Formula | C20H28N5O12P |
| Molecular Weight | 561.44 g/mol |
| Exact Mass | 561.15 |
| IUPAC Name | [(2R,3R,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-(hydroxymethyl)-4-methoxyoxolan-3-yl] [(2R,3S,5R)-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl hydrogen phosphate |
| SMILES | CO[C@@H]1[C@H](OP(=O)(O)OC[C@H]2O[C@@H](n3cc(C)c(=O)[nH]c3=O)C[C@@H]2O)[C@@H](CO)O[C@H]1n1ccc(N)nc1=O |
| InChI | InChI=1S/C20H28N5O12P/c1-9-6-25(20(30)23-17(9)28)14-5-10(27)12(35-14)8-34-38(31,32)37-15-11(7-26)36-18(16(15)33-2)24-4-3-13(21)22-19(24)29/h3-4,6,10-12,14-16,18,26-27H,5,7-8H2,1-2H3,(H,31,32)(H2,21,22,29)(H,23,28,30)/t10-,11+,12+,14+,15+,16+,18+/m0/s1 |
| InChIKey | OWBQRRKGWQTRFV-WWJUSVCISA-N |
| XLogP | -2.26 |
| TPSA | 239.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.44 |
| LogP ≤ 5 | -2.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|