C12H20N3O6PS — CID 58319627
4-amino-1-[(2R,3S,5R)-5-ethyl-4-[hydroxy(methoxy)phosphinothioyl]oxy-3-methoxyoxolan-2-yl]pyrimidin-2-one (PubChem CID 58319627) has the molecular formula C12H20N3O6PS and a molecular weight of 365.35 g/mol. Its IUPAC name is 4-amino-1-[(2R,3S,5R)-5-ethyl-4-[hydroxy(methoxy)phosphinothioyl]oxy-3-methoxyoxolan-2-yl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[(2R,3S,5R)-5-ethyl-4-[hydroxy(methoxy)phosphinothioyl]oxy-3-methoxyoxolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 58319627 |
| Molecular Formula | C12H20N3O6PS |
| Molecular Weight | 365.35 g/mol |
| Exact Mass | 365.08 |
| IUPAC Name | 4-amino-1-[(2R,3S,5R)-5-ethyl-4-[hydroxy(methoxy)phosphinothioyl]oxy-3-methoxyoxolan-2-yl]pyrimidin-2-one |
| SMILES | CC[C@H]1O[C@@H](n2ccc(N)nc2=O)[C@@H](OC)C1OP(O)(=S)OC |
| InChI | InChI=1S/C12H20N3O6PS/c1-4-7-9(21-22(17,23)19-3)10(18-2)11(20-7)15-6-5-8(13)14-12(15)16/h5-7,9-11H,4H2,1-3H3,(H,17,23)(H2,13,14,16)/t7-,9?,10+,11-,22?/m1/s1 |
| InChIKey | NPMLAOXAVDNSBP-CGSFDUFMSA-N |
| XLogP | 0.40 |
| TPSA | 118.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.35 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|