C11H18N3O6PS — CID 88877961
4-amino-1-[(2R,5R)-5-ethyl-3-hydroxy-4-[hydroxy(methoxy)phosphinothioyl]oxyoxolan-2-yl]pyrimidin-2-one (PubChem CID 88877961) has the molecular formula C11H18N3O6PS and a molecular weight of 351.32 g/mol. Its IUPAC name is 4-amino-1-[(2R,5R)-5-ethyl-3-hydroxy-4-[hydroxy(methoxy)phosphinothioyl]oxyoxolan-2-yl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[(2R,5R)-5-ethyl-3-hydroxy-4-[hydroxy(methoxy)phosphinothioyl]oxyoxolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 88877961 |
| Molecular Formula | C11H18N3O6PS |
| Molecular Weight | 351.32 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | 4-amino-1-[(2R,5R)-5-ethyl-3-hydroxy-4-[hydroxy(methoxy)phosphinothioyl]oxyoxolan-2-yl]pyrimidin-2-one |
| SMILES | CC[C@H]1O[C@@H](n2ccc(N)nc2=O)C(O)C1OP(O)(=S)OC |
| InChI | InChI=1S/C11H18N3O6PS/c1-3-6-9(20-21(17,22)18-2)8(15)10(19-6)14-5-4-7(12)13-11(14)16/h4-6,8-10,15H,3H2,1-2H3,(H,17,22)(H2,12,13,16)/t6-,8?,9?,10-,21?/m1/s1 |
| InChIKey | XAAGQFFAKZLZIS-HETAOPMYSA-N |
| XLogP | -0.26 |
| TPSA | 129.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.32 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|