C23H33N5O8 — CID 21177237
[(2R,3R,4R)-5-(2-amino-1-methyl-6-oxopurin-9-yl)-3,4-bis(2-methylpropanoyloxy)oxolan-2-yl]methyl 2-methylpropanoate (PubChem CID 21177237) has the molecular formula C23H33N5O8 and a molecular weight of 507.54 g/mol. Its IUPAC name is [(2R,3R,4R)-5-(2-amino-1-methyl-6-oxopurin-9-yl)-3,4-bis(2-methylpropanoyloxy)oxolan-2-yl]methyl 2-methylpropanoate.
| Compound Name | [(2R,3R,4R)-5-(2-amino-1-methyl-6-oxopurin-9-yl)-3,4-bis(2-methylpropanoyloxy)oxolan-2-yl]methyl 2-methylpropanoate |
|---|---|
| PubChem CID | 21177237 |
| Molecular Formula | C23H33N5O8 |
| Molecular Weight | 507.54 g/mol |
| Exact Mass | 507.23 |
| IUPAC Name | [(2R,3R,4R)-5-(2-amino-1-methyl-6-oxopurin-9-yl)-3,4-bis(2-methylpropanoyloxy)oxolan-2-yl]methyl 2-methylpropanoate |
| SMILES | CC(C)C(=O)OC[C@H]1OC(n2cnc3c(=O)n(C)c(N)nc32)[C@H](OC(=O)C(C)C)[C@@H]1OC(=O)C(C)C |
| InChI | InChI=1S/C23H33N5O8/c1-10(2)20(30)33-8-13-15(35-21(31)11(3)4)16(36-22(32)12(5)6)19(34-13)28-9-25-14-17(28)26-23(24)27(7)18(14)29/h9-13,15-16,19H,8H2,1-7H3,(H2,24,26)/t13-,15-,16-,19?/m1/s1 |
| InChIKey | BEAABZFRESSWAK-XAUNWSGPSA-N |
| XLogP | 0.94 |
| TPSA | 166.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.54 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|