C26H37N5O8 — CID 59069998
[(2R,3R,4R)-3,4-bis(2-methylpropanoyloxy)-5-[6-(oxolan-3-ylamino)purin-9-yl]oxolan-2-yl]methyl 2-methylpropanoate (PubChem CID 59069998) has the molecular formula C26H37N5O8 and a molecular weight of 547.61 g/mol. Its IUPAC name is [(2R,3R,4R)-3,4-bis(2-methylpropanoyloxy)-5-[6-(oxolan-3-ylamino)purin-9-yl]oxolan-2-yl]methyl 2-methylpropanoate.
| Compound Name | [(2R,3R,4R)-3,4-bis(2-methylpropanoyloxy)-5-[6-(oxolan-3-ylamino)purin-9-yl]oxolan-2-yl]methyl 2-methylpropanoate |
|---|---|
| PubChem CID | 59069998 |
| Molecular Formula | C26H37N5O8 |
| Molecular Weight | 547.61 g/mol |
| Exact Mass | 547.26 |
| IUPAC Name | [(2R,3R,4R)-3,4-bis(2-methylpropanoyloxy)-5-[6-(oxolan-3-ylamino)purin-9-yl]oxolan-2-yl]methyl 2-methylpropanoate |
| SMILES | CC(C)C(=O)OC[C@H]1OC(n2cnc3c(NC4CCOC4)ncnc32)[C@H](OC(=O)C(C)C)[C@@H]1OC(=O)C(C)C |
| InChI | InChI=1S/C26H37N5O8/c1-13(2)24(32)36-10-17-19(38-25(33)14(3)4)20(39-26(34)15(5)6)23(37-17)31-12-29-18-21(27-11-28-22(18)31)30-16-7-8-35-9-16/h11-17,19-20,23H,7-10H2,1-6H3,(H,27,28,30)/t16?,17-,19-,20-,23?/m1/s1 |
| InChIKey | AMQHKGJBNMACRV-OKCGCYJWSA-N |
| XLogP | 2.26 |
| TPSA | 152.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.61 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|