C17H22N6O8 — CID 20592011
2-[[(2R,3S,4R,5R)-3,4-dihydroxy-5-[6-[[(3R)-oxolan-3-yl]amino]purin-9-yl]oxolan-2-yl]methoxycarbonylamino]acetic acid (PubChem CID 20592011) has the molecular formula C17H22N6O8 and a molecular weight of 438.40 g/mol. Its IUPAC name is 2-[[(2R,3S,4R,5R)-3,4-dihydroxy-5-[6-[[(3R)-oxolan-3-yl]amino]purin-9-yl]oxolan-2-yl]methoxycarbonylamino]acetic acid.
| Compound Name | 2-[[(2R,3S,4R,5R)-3,4-dihydroxy-5-[6-[[(3R)-oxolan-3-yl]amino]purin-9-yl]oxolan-2-yl]methoxycarbonylamino]acetic acid |
|---|---|
| PubChem CID | 20592011 |
| Molecular Formula | C17H22N6O8 |
| Molecular Weight | 438.40 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | 2-[[(2R,3S,4R,5R)-3,4-dihydroxy-5-[6-[[(3R)-oxolan-3-yl]amino]purin-9-yl]oxolan-2-yl]methoxycarbonylamino]acetic acid |
| SMILES | O=C(O)CNC(=O)OC[C@H]1O[C@@H](n2cnc3c(N[C@@H]4CCOC4)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C17H22N6O8/c24-10(25)3-18-17(28)30-5-9-12(26)13(27)16(31-9)23-7-21-11-14(19-6-20-15(11)23)22-8-1-2-29-4-8/h6-9,12-13,16,26-27H,1-5H2,(H,18,28)(H,24,25)(H,19,20,22)/t8-,9-,12-,13-,16-/m1/s1 |
| InChIKey | VEWPOPOFADQUST-VRRMXIQQSA-N |
| XLogP | -1.54 |
| TPSA | 190.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.40 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |