C20H28N6O7S — CID 10141539
ethyl 3-[[(2R,3S)-3,4-dihydroxy-5-[6-(oxolan-3-ylamino)purin-9-yl]oxolan-2-yl]methoxycarbothioylamino]propanoate (PubChem CID 10141539) has the molecular formula C20H28N6O7S and a molecular weight of 496.55 g/mol. Its IUPAC name is ethyl 3-[[(2R,3S)-3,4-dihydroxy-5-[6-(oxolan-3-ylamino)purin-9-yl]oxolan-2-yl]methoxycarbothioylamino]propanoate.
| Compound Name | ethyl 3-[[(2R,3S)-3,4-dihydroxy-5-[6-(oxolan-3-ylamino)purin-9-yl]oxolan-2-yl]methoxycarbothioylamino]propanoate |
|---|---|
| PubChem CID | 10141539 |
| Molecular Formula | C20H28N6O7S |
| Molecular Weight | 496.55 g/mol |
| Exact Mass | 496.17 |
| IUPAC Name | ethyl 3-[[(2R,3S)-3,4-dihydroxy-5-[6-(oxolan-3-ylamino)purin-9-yl]oxolan-2-yl]methoxycarbothioylamino]propanoate |
| SMILES | CCOC(=O)CCNC(=S)OC[C@H]1OC(n2cnc3c(NC4CCOC4)ncnc32)C(O)[C@@H]1O |
| InChI | InChI=1S/C20H28N6O7S/c1-2-31-13(27)3-5-21-20(34)32-8-12-15(28)16(29)19(33-12)26-10-24-14-17(22-9-23-18(14)26)25-11-4-6-30-7-11/h9-12,15-16,19,28-29H,2-8H2,1H3,(H,21,34)(H,22,23,25)/t11?,12-,15-,16?,19?/m1/s1 |
| InChIKey | QFFVCSDQPMYNKY-MEMGVEGOSA-N |
| XLogP | -0.51 |
| TPSA | 162.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.55 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|