C19H26N6O5S — CID 10204270
O-[[(2R,3S,4R)-3,4-dihydroxy-5-[6-[[(3R)-oxolan-3-yl]amino]purin-9-yl]oxolan-2-yl]methyl] N-cyclobutylcarbamothioate (PubChem CID 10204270) has the molecular formula C19H26N6O5S and a molecular weight of 450.52 g/mol. Its IUPAC name is O-[[(2R,3S,4R)-3,4-dihydroxy-5-[6-[[(3R)-oxolan-3-yl]amino]purin-9-yl]oxolan-2-yl]methyl] N-cyclobutylcarbamothioate.
| Compound Name | O-[[(2R,3S,4R)-3,4-dihydroxy-5-[6-[[(3R)-oxolan-3-yl]amino]purin-9-yl]oxolan-2-yl]methyl] N-cyclobutylcarbamothioate |
|---|---|
| PubChem CID | 10204270 |
| Molecular Formula | C19H26N6O5S |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | O-[[(2R,3S,4R)-3,4-dihydroxy-5-[6-[[(3R)-oxolan-3-yl]amino]purin-9-yl]oxolan-2-yl]methyl] N-cyclobutylcarbamothioate |
| SMILES | O[C@@H]1[C@@H](COC(=S)NC2CCC2)OC(n2cnc3c(N[C@@H]4CCOC4)ncnc32)[C@@H]1O |
| InChI | InChI=1S/C19H26N6O5S/c26-14-12(7-29-19(31)24-10-2-1-3-10)30-18(15(14)27)25-9-22-13-16(20-8-21-17(13)25)23-11-4-5-28-6-11/h8-12,14-15,18,26-27H,1-7H2,(H,24,31)(H,20,21,23)/t11-,12-,14-,15-,18?/m1/s1 |
| InChIKey | MSLJQVMLYRRSTP-TWNDCJQTSA-N |
| XLogP | 0.09 |
| TPSA | 135.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|