C17H24N5O6- — CID 86590484
(2R,3R,4S,5R)-2-(hydroxymethyl)-5-[6-(oxolan-3-ylamino)purin-9-yl]oxolane-3,4-diol;prop-1-en-2-olate (PubChem CID 86590484) has the molecular formula C17H24N5O6- and a molecular weight of 394.41 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(hydroxymethyl)-5-[6-(oxolan-3-ylamino)purin-9-yl]oxolane-3,4-diol;prop-1-en-2-olate.
| Compound Name | (2R,3R,4S,5R)-2-(hydroxymethyl)-5-[6-(oxolan-3-ylamino)purin-9-yl]oxolane-3,4-diol;prop-1-en-2-olate |
|---|---|
| PubChem CID | 86590484 |
| Molecular Formula | C17H24N5O6- |
| Molecular Weight | 394.41 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | (2R,3R,4S,5R)-2-(hydroxymethyl)-5-[6-(oxolan-3-ylamino)purin-9-yl]oxolane-3,4-diol;prop-1-en-2-olate |
| SMILES | C=C(C)[O-].OC[C@H]1O[C@@H](n2cnc3c(NC4CCOC4)ncnc32)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C14H19N5O5.C3H6O/c20-3-8-10(21)11(22)14(24-8)19-6-17-9-12(15-5-16-13(9)19)18-7-1-2-23-4-7;1-3(2)4/h5-8,10-11,14,20-22H,1-4H2,(H,15,16,18);4H,1H2,2H3/p-1/t7?,8-,10+,11+,14-;/m1./s1 |
| InChIKey | GTFCRBJGUCQYNG-NGGGGLAZSA-M |
| XLogP | -1.48 |
| TPSA | 157.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.41 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|