C15H21N5O5 — CID 59070007
(2R,3S,4R,5R)-2-[[deuterio(tritio)methoxy]methyl]-5-[6-[[(3R)-oxolan-3-yl]amino]purin-9-yl]oxolane-3,4-diol (PubChem CID 59070007) has the molecular formula C15H21N5O5 and a molecular weight of 354.38 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2-[[deuterio(tritio)methoxy]methyl]-5-[6-[[(3R)-oxolan-3-yl]amino]purin-9-yl]oxolane-3,4-diol.
| Compound Name | (2R,3S,4R,5R)-2-[[deuterio(tritio)methoxy]methyl]-5-[6-[[(3R)-oxolan-3-yl]amino]purin-9-yl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 59070007 |
| Molecular Formula | C15H21N5O5 |
| Molecular Weight | 354.38 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | (2R,3S,4R,5R)-2-[[deuterio(tritio)methoxy]methyl]-5-[6-[[(3R)-oxolan-3-yl]amino]purin-9-yl]oxolane-3,4-diol |
| SMILES | [2H]C([3H])OC[C@H]1O[C@@H](n2cnc3c(N[C@@H]4CCOC4)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C15H21N5O5/c1-23-5-9-11(21)12(22)15(25-9)20-7-18-10-13(16-6-17-14(10)20)19-8-2-3-24-4-8/h6-9,11-12,15,21-22H,2-5H2,1H3,(H,16,17,19)/t8-,9-,11-,12-,15-/m1/s1/i1TD/t1?,8-,9-,11-,12-,15- |
| InChIKey | IFBKOTXAKILWJK-DVPKIHSWSA-N |
| XLogP | -0.71 |
| TPSA | 123.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.38 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |