C18H22N6O6 — CID 66696720
(2R,3R,4R,5R)-2-[(5-methyl-1,2-oxazol-3-yl)oxymethyl]-5-[6-(oxolan-3-ylamino)purin-9-yl]oxolane-3,4-diol (PubChem CID 66696720) has the molecular formula C18H22N6O6 and a molecular weight of 418.41 g/mol. Its IUPAC name is (2R,3R,4R,5R)-2-[(5-methyl-1,2-oxazol-3-yl)oxymethyl]-5-[6-(oxolan-3-ylamino)purin-9-yl]oxolane-3,4-diol.
| Compound Name | (2R,3R,4R,5R)-2-[(5-methyl-1,2-oxazol-3-yl)oxymethyl]-5-[6-(oxolan-3-ylamino)purin-9-yl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 66696720 |
| Molecular Formula | C18H22N6O6 |
| Molecular Weight | 418.41 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | (2R,3R,4R,5R)-2-[(5-methyl-1,2-oxazol-3-yl)oxymethyl]-5-[6-(oxolan-3-ylamino)purin-9-yl]oxolane-3,4-diol |
| SMILES | Cc1cc(OC[C@H]2O[C@@H](n3cnc4c(NC5CCOC5)ncnc43)[C@H](O)[C@H]2O)no1 |
| InChI | InChI=1S/C18H22N6O6/c1-9-4-12(23-30-9)28-6-11-14(25)15(26)18(29-11)24-8-21-13-16(19-7-20-17(13)24)22-10-2-3-27-5-10/h4,7-8,10-11,14-15,18,25-26H,2-3,5-6H2,1H3,(H,19,20,22)/t10?,11-,14+,15-,18-/m1/s1 |
| InChIKey | MCLZIYRGKPLKSW-PZCYAHBXSA-N |
| XLogP | 0.02 |
| TPSA | 149.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.41 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |