C21H30N6O5S — CID 10162723
O-[[(2R,3S,4R)-3,4-dihydroxy-5-[6-[[(3R)-oxolan-3-yl]amino]purin-9-yl]oxolan-2-yl]methyl] N-cyclohexylcarbamothioate (PubChem CID 10162723) has the molecular formula C21H30N6O5S and a molecular weight of 478.58 g/mol. Its IUPAC name is O-[[(2R,3S,4R)-3,4-dihydroxy-5-[6-[[(3R)-oxolan-3-yl]amino]purin-9-yl]oxolan-2-yl]methyl] N-cyclohexylcarbamothioate.
| Compound Name | O-[[(2R,3S,4R)-3,4-dihydroxy-5-[6-[[(3R)-oxolan-3-yl]amino]purin-9-yl]oxolan-2-yl]methyl] N-cyclohexylcarbamothioate |
|---|---|
| PubChem CID | 10162723 |
| Molecular Formula | C21H30N6O5S |
| Molecular Weight | 478.58 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | O-[[(2R,3S,4R)-3,4-dihydroxy-5-[6-[[(3R)-oxolan-3-yl]amino]purin-9-yl]oxolan-2-yl]methyl] N-cyclohexylcarbamothioate |
| SMILES | O[C@@H]1[C@@H](COC(=S)NC2CCCCC2)OC(n2cnc3c(N[C@@H]4CCOC4)ncnc32)[C@@H]1O |
| InChI | InChI=1S/C21H30N6O5S/c28-16-14(9-31-21(33)26-12-4-2-1-3-5-12)32-20(17(16)29)27-11-24-15-18(22-10-23-19(15)27)25-13-6-7-30-8-13/h10-14,16-17,20,28-29H,1-9H2,(H,26,33)(H,22,23,25)/t13-,14-,16-,17-,20?/m1/s1 |
| InChIKey | CSESPDVPHOWLJZ-ZIOSIIRKSA-N |
| XLogP | 0.87 |
| TPSA | 135.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.58 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|