C27H34N6O6S — CID 10231630
O-[[(2R,3S,4R)-3,4-dihydroxy-5-[6-[[(3R)-oxolan-3-yl]amino]purin-9-yl]oxolan-2-yl]methyl] N-[(1S,2S)-2-phenylmethoxycyclopentyl]carbamothioate (PubChem CID 10231630) has the molecular formula C27H34N6O6S and a molecular weight of 570.67 g/mol. Its IUPAC name is O-[[(2R,3S,4R)-3,4-dihydroxy-5-[6-[[(3R)-oxolan-3-yl]amino]purin-9-yl]oxolan-2-yl]methyl] N-[(1S,2S)-2-phenylmethoxycyclopentyl]carbamothioate.
| Compound Name | O-[[(2R,3S,4R)-3,4-dihydroxy-5-[6-[[(3R)-oxolan-3-yl]amino]purin-9-yl]oxolan-2-yl]methyl] N-[(1S,2S)-2-phenylmethoxycyclopentyl]carbamothioate |
|---|---|
| PubChem CID | 10231630 |
| Molecular Formula | C27H34N6O6S |
| Molecular Weight | 570.67 g/mol |
| Exact Mass | 570.23 |
| IUPAC Name | O-[[(2R,3S,4R)-3,4-dihydroxy-5-[6-[[(3R)-oxolan-3-yl]amino]purin-9-yl]oxolan-2-yl]methyl] N-[(1S,2S)-2-phenylmethoxycyclopentyl]carbamothioate |
| SMILES | O[C@@H]1[C@@H](COC(=S)N[C@H]2CCC[C@@H]2OCc2ccccc2)OC(n2cnc3c(N[C@@H]4CCOC4)ncnc32)[C@@H]1O |
| InChI | InChI=1S/C27H34N6O6S/c34-22-20(13-38-27(40)32-18-7-4-8-19(18)37-11-16-5-2-1-3-6-16)39-26(23(22)35)33-15-30-21-24(28-14-29-25(21)33)31-17-9-10-36-12-17/h1-3,5-6,14-15,17-20,22-23,26,34-35H,4,7-13H2,(H,32,40)(H,28,29,31)/t17-,18+,19+,20-,22-,23-,26?/m1/s1 |
| InChIKey | AUCDFDZQUDBEOK-BWFZDFDASA-N |
| XLogP | 1.68 |
| TPSA | 145.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.67 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|