C20H28N6O5S — CID 173273535
[(2R,3R,5R)-2-[6-[[(3R)-oxolan-3-yl]amino]purin-9-yl]-5-(propylcarbamothioyloxymethyl)oxolan-3-yl] acetate (PubChem CID 173273535) has the molecular formula C20H28N6O5S and a molecular weight of 464.55 g/mol. Its IUPAC name is [(2R,3R,5R)-2-[6-[[(3R)-oxolan-3-yl]amino]purin-9-yl]-5-(propylcarbamothioyloxymethyl)oxolan-3-yl] acetate.
| Compound Name | [(2R,3R,5R)-2-[6-[[(3R)-oxolan-3-yl]amino]purin-9-yl]-5-(propylcarbamothioyloxymethyl)oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 173273535 |
| Molecular Formula | C20H28N6O5S |
| Molecular Weight | 464.55 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | [(2R,3R,5R)-2-[6-[[(3R)-oxolan-3-yl]amino]purin-9-yl]-5-(propylcarbamothioyloxymethyl)oxolan-3-yl] acetate |
| SMILES | CCCNC(=S)OC[C@H]1C[C@@H](OC(C)=O)[C@H](n2cnc3c(N[C@@H]4CCOC4)ncnc32)O1 |
| InChI | InChI=1S/C20H28N6O5S/c1-3-5-21-20(32)29-9-14-7-15(30-12(2)27)19(31-14)26-11-24-16-17(22-10-23-18(16)26)25-13-4-6-28-8-13/h10-11,13-15,19H,3-9H2,1-2H3,(H,21,32)(H,22,23,25)/t13-,14-,15-,19-/m1/s1 |
| InChIKey | IVXZTWRRIIQZKA-DEXNDLTESA-N |
| XLogP | 1.55 |
| TPSA | 121.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.55 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|