C23H32N6O8 — CID 91176538
[(2R,3R,4R)-3,4-diacetyloxy-5-[6-[[(3R)-oxolan-3-yl]amino]purin-9-yl]oxolan-2-yl]methyl (2S)-2-amino-3-methylbutanoate (PubChem CID 91176538) has the molecular formula C23H32N6O8 and a molecular weight of 520.54 g/mol. Its IUPAC name is [(2R,3R,4R)-3,4-diacetyloxy-5-[6-[[(3R)-oxolan-3-yl]amino]purin-9-yl]oxolan-2-yl]methyl (2S)-2-amino-3-methylbutanoate.
| Compound Name | [(2R,3R,4R)-3,4-diacetyloxy-5-[6-[[(3R)-oxolan-3-yl]amino]purin-9-yl]oxolan-2-yl]methyl (2S)-2-amino-3-methylbutanoate |
|---|---|
| PubChem CID | 91176538 |
| Molecular Formula | C23H32N6O8 |
| Molecular Weight | 520.54 g/mol |
| Exact Mass | 520.23 |
| IUPAC Name | [(2R,3R,4R)-3,4-diacetyloxy-5-[6-[[(3R)-oxolan-3-yl]amino]purin-9-yl]oxolan-2-yl]methyl (2S)-2-amino-3-methylbutanoate |
| SMILES | CC(=O)O[C@@H]1[C@@H](COC(=O)[C@@H](N)C(C)C)OC(n2cnc3c(N[C@@H]4CCOC4)ncnc32)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C23H32N6O8/c1-11(2)16(24)23(32)34-8-15-18(35-12(3)30)19(36-13(4)31)22(37-15)29-10-27-17-20(25-9-26-21(17)29)28-14-5-6-33-7-14/h9-11,14-16,18-19,22H,5-8,24H2,1-4H3,(H,25,26,28)/t14-,15-,16+,18-,19-,22?/m1/s1 |
| InChIKey | NTQRHQMXSPAYJM-IXKBKHBMSA-N |
| XLogP | 0.31 |
| TPSA | 179.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.54 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|