C25H38N8O9 — CID 24997360
[(2R,3R,4R,5R)-4-[(2S)-2-amino-3-methylbutanoyl]oxy-5-[6-[[(1S,3R)-3-hydroxycyclopentyl]amino]purin-9-yl]-2-(nitrooxymethyl)oxolan-3-yl] (2S)-2-amino-3-methylbutanoate (PubChem CID 24997360) has the molecular formula C25H38N8O9 and a molecular weight of 594.63 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-4-[(2S)-2-amino-3-methylbutanoyl]oxy-5-[6-[[(1S,3R)-3-hydroxycyclopentyl]amino]purin-9-yl]-2-(nitrooxymethyl)oxolan-3-yl] (2S)-2-amino-3-methylbutanoate.
| Compound Name | [(2R,3R,4R,5R)-4-[(2S)-2-amino-3-methylbutanoyl]oxy-5-[6-[[(1S,3R)-3-hydroxycyclopentyl]amino]purin-9-yl]-2-(nitrooxymethyl)oxolan-3-yl] (2S)-2-amino-3-methylbutanoate |
|---|---|
| PubChem CID | 24997360 |
| Molecular Formula | C25H38N8O9 |
| Molecular Weight | 594.63 g/mol |
| Exact Mass | 594.28 |
| IUPAC Name | [(2R,3R,4R,5R)-4-[(2S)-2-amino-3-methylbutanoyl]oxy-5-[6-[[(1S,3R)-3-hydroxycyclopentyl]amino]purin-9-yl]-2-(nitrooxymethyl)oxolan-3-yl] (2S)-2-amino-3-methylbutanoate |
| SMILES | CC(C)[C@H](N)C(=O)O[C@@H]1[C@H](OC(=O)[C@@H](N)C(C)C)[C@@H](CO[N+](=O)[O-])O[C@H]1n1cnc2c(N[C@H]3CC[C@@H](O)C3)ncnc21 |
| InChI | InChI=1S/C25H38N8O9/c1-11(2)16(26)24(35)41-19-15(8-39-33(37)38)40-23(20(19)42-25(36)17(27)12(3)4)32-10-30-18-21(28-9-29-22(18)32)31-13-5-6-14(34)7-13/h9-17,19-20,23,34H,5-8,26-27H2,1-4H3,(H,28,29,31)/t13-,14+,15+,16-,17-,19+,20+,23+/m0/s1 |
| InChIKey | SKUYZTWYMFHXPX-IBYLKTNHSA-N |
| XLogP | 0.05 |
| TPSA | 242.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.63 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|