C25H37ClN8O8 — CID 25001166
[(2R,3R,4R,5R)-4-[(2S)-2-amino-3-methylbutanoyl]oxy-5-[2-chloro-6-(cyclopentylamino)purin-9-yl]-2-(nitrooxymethyl)oxolan-3-yl] (2R)-2-amino-3-methylbutanoate (PubChem CID 25001166) has the molecular formula C25H37ClN8O8 and a molecular weight of 613.07 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-4-[(2S)-2-amino-3-methylbutanoyl]oxy-5-[2-chloro-6-(cyclopentylamino)purin-9-yl]-2-(nitrooxymethyl)oxolan-3-yl] (2R)-2-amino-3-methylbutanoate.
| Compound Name | [(2R,3R,4R,5R)-4-[(2S)-2-amino-3-methylbutanoyl]oxy-5-[2-chloro-6-(cyclopentylamino)purin-9-yl]-2-(nitrooxymethyl)oxolan-3-yl] (2R)-2-amino-3-methylbutanoate |
|---|---|
| PubChem CID | 25001166 |
| Molecular Formula | C25H37ClN8O8 |
| Molecular Weight | 613.07 g/mol |
| Exact Mass | 612.24 |
| IUPAC Name | [(2R,3R,4R,5R)-4-[(2S)-2-amino-3-methylbutanoyl]oxy-5-[2-chloro-6-(cyclopentylamino)purin-9-yl]-2-(nitrooxymethyl)oxolan-3-yl] (2R)-2-amino-3-methylbutanoate |
| SMILES | CC(C)[C@H](N)C(=O)O[C@@H]1[C@H](OC(=O)[C@H](N)C(C)C)[C@@H](CO[N+](=O)[O-])O[C@H]1n1cnc2c(NC3CCCC3)nc(Cl)nc21 |
| InChI | InChI=1S/C25H37ClN8O8/c1-11(2)15(27)23(35)41-18-14(9-39-34(37)38)40-22(19(18)42-24(36)16(28)12(3)4)33-10-29-17-20(30-13-7-5-6-8-13)31-25(26)32-21(17)33/h10-16,18-19,22H,5-9,27-28H2,1-4H3,(H,30,31,32)/t14-,15-,16+,18-,19-,22-/m1/s1 |
| InChIKey | OUNVTYIYWJDLJJ-KSSRIFPZSA-N |
| XLogP | 1.73 |
| TPSA | 221.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.07 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|