C22H30N6O8 — CID 20592056
[(2R,3R,4R,5R)-3,4-diacetyloxy-5-[8-(ethylamino)-6-[[(3R)-oxolan-3-yl]amino]purin-9-yl]oxolan-2-yl]methyl acetate (PubChem CID 20592056) has the molecular formula C22H30N6O8 and a molecular weight of 506.52 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3,4-diacetyloxy-5-[8-(ethylamino)-6-[[(3R)-oxolan-3-yl]amino]purin-9-yl]oxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-[8-(ethylamino)-6-[[(3R)-oxolan-3-yl]amino]purin-9-yl]oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 20592056 |
| Molecular Formula | C22H30N6O8 |
| Molecular Weight | 506.52 g/mol |
| Exact Mass | 506.21 |
| IUPAC Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-[8-(ethylamino)-6-[[(3R)-oxolan-3-yl]amino]purin-9-yl]oxolan-2-yl]methyl acetate |
| SMILES | CCNc1nc2c(N[C@@H]3CCOC3)ncnc2n1[C@@H]1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C22H30N6O8/c1-5-23-22-27-16-19(26-14-6-7-32-8-14)24-10-25-20(16)28(22)21-18(35-13(4)31)17(34-12(3)30)15(36-21)9-33-11(2)29/h10,14-15,17-18,21H,5-9H2,1-4H3,(H,23,27)(H,24,25,26)/t14-,15-,17-,18-,21-/m1/s1 |
| InChIKey | ZEZCKDOYZJTJEP-SQDDPSDBSA-N |
| XLogP | 0.78 |
| TPSA | 165.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.52 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|