C21H29N5O7S — CID 11785232
[(2R,3R,4R,5R)-3,4-diacetyloxy-5-[8-(pentylamino)-6-sulfanylidene-3H-purin-9-yl]oxolan-2-yl]methyl acetate (PubChem CID 11785232) has the molecular formula C21H29N5O7S and a molecular weight of 495.56 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3,4-diacetyloxy-5-[8-(pentylamino)-6-sulfanylidene-3H-purin-9-yl]oxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-[8-(pentylamino)-6-sulfanylidene-3H-purin-9-yl]oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 11785232 |
| Molecular Formula | C21H29N5O7S |
| Molecular Weight | 495.56 g/mol |
| Exact Mass | 495.18 |
| IUPAC Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-[8-(pentylamino)-6-sulfanylidene-3H-purin-9-yl]oxolan-2-yl]methyl acetate |
| SMILES | CCCCCNc1nc2c(=S)nc[nH]c2n1[C@@H]1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C21H29N5O7S/c1-5-6-7-8-22-21-25-15-18(23-10-24-19(15)34)26(21)20-17(32-13(4)29)16(31-12(3)28)14(33-20)9-30-11(2)27/h10,14,16-17,20H,5-9H2,1-4H3,(H,22,25)(H,23,24,34)/t14-,16-,17-,20-/m1/s1 |
| InChIKey | JMRCXPHCCALSFE-WVSUBDOOSA-N |
| XLogP | 2.41 |
| TPSA | 146.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.56 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|