C17H21N5O5S2 — CID 3922245
[4-acetyloxy-3-[ethanethioyl(methyl)amino]-5-(6-sulfanylidene-3H-purin-9-yl)oxolan-2-yl]methyl acetate (PubChem CID 3922245) has the molecular formula C17H21N5O5S2 and a molecular weight of 439.52 g/mol. Its IUPAC name is [4-acetyloxy-3-[ethanethioyl(methyl)amino]-5-(6-sulfanylidene-3H-purin-9-yl)oxolan-2-yl]methyl acetate.
| Compound Name | [4-acetyloxy-3-[ethanethioyl(methyl)amino]-5-(6-sulfanylidene-3H-purin-9-yl)oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 3922245 |
| Molecular Formula | C17H21N5O5S2 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.10 |
| IUPAC Name | [4-acetyloxy-3-[ethanethioyl(methyl)amino]-5-(6-sulfanylidene-3H-purin-9-yl)oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(n2cnc3c(=S)nc[nH]c32)C(OC(C)=O)C1N(C)C(C)=S |
| InChI | InChI=1S/C17H21N5O5S2/c1-8(28)21(4)13-11(5-25-9(2)23)27-17(14(13)26-10(3)24)22-7-20-12-15(22)18-6-19-16(12)29/h6-7,11,13-14,17H,5H2,1-4H3,(H,18,19,29) |
| InChIKey | ILKLSOUSFFKWLF-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 111.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|