C10H11N4Na2O7PS — CID 20765491
disodium;[(2R,3S,4R,5R)-3,4-dihydroxy-5-(6-sulfanylidene-3H-purin-9-yl)oxolan-2-yl]methyl phosphate (PubChem CID 20765491) has the molecular formula C10H11N4Na2O7PS and a molecular weight of 408.24 g/mol. Its IUPAC name is disodium;[(2R,3S,4R,5R)-3,4-dihydroxy-5-(6-sulfanylidene-3H-purin-9-yl)oxolan-2-yl]methyl phosphate.
| Compound Name | disodium;[(2R,3S,4R,5R)-3,4-dihydroxy-5-(6-sulfanylidene-3H-purin-9-yl)oxolan-2-yl]methyl phosphate |
|---|---|
| PubChem CID | 20765491 |
| Molecular Formula | C10H11N4Na2O7PS |
| Molecular Weight | 408.24 g/mol |
| Exact Mass | 407.99 |
| IUPAC Name | disodium;[(2R,3S,4R,5R)-3,4-dihydroxy-5-(6-sulfanylidene-3H-purin-9-yl)oxolan-2-yl]methyl phosphate |
| SMILES | O=P([O-])([O-])OC[C@H]1O[C@@H](n2cnc3c(=S)nc[nH]c32)[C@H](O)[C@@H]1O.[Na+].[Na+] |
| InChI | InChI=1S/C10H13N4O7PS.2Na/c15-6-4(1-20-22(17,18)19)21-10(7(6)16)14-3-13-5-8(14)11-2-12-9(5)23;;/h2-4,6-7,10,15-16H,1H2,(H,11,12,23)(H2,17,18,19);;/q;2*+1/p-2/t4-,6-,7-,10-;;/m1../s1 |
| InChIKey | ZHAPIMLHOLGBIX-IDIVVRGQSA-L |
| XLogP | -8.04 |
| TPSA | 168.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.24 |
| LogP ≤ 5 | -8.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|