C26H26N9O12PS2 — CID 4017538
bis[[3,4-dihydroxy-5-(6-sulfanylidene-3H-purin-9-yl)oxolan-2-yl]methyl] (4-nitrophenyl) phosphate (PubChem CID 4017538) has the molecular formula C26H26N9O12PS2 and a molecular weight of 751.65 g/mol. Its IUPAC name is bis[[3,4-dihydroxy-5-(6-sulfanylidene-3H-purin-9-yl)oxolan-2-yl]methyl] (4-nitrophenyl) phosphate.
| Compound Name | bis[[3,4-dihydroxy-5-(6-sulfanylidene-3H-purin-9-yl)oxolan-2-yl]methyl] (4-nitrophenyl) phosphate |
|---|---|
| PubChem CID | 4017538 |
| Molecular Formula | C26H26N9O12PS2 |
| Molecular Weight | 751.65 g/mol |
| Exact Mass | 751.09 |
| IUPAC Name | bis[[3,4-dihydroxy-5-(6-sulfanylidene-3H-purin-9-yl)oxolan-2-yl]methyl] (4-nitrophenyl) phosphate |
| SMILES | O=[N+]([O-])c1ccc(OP(=O)(OCC2OC(n3cnc4c(=S)nc[nH]c43)C(O)C2O)OCC2OC(n3cnc4c(=S)nc[nH]c43)C(O)C2O)cc1 |
| InChI | InChI=1S/C26H26N9O12PS2/c36-17-13(45-25(19(17)38)33-9-31-15-21(33)27-7-29-23(15)49)5-43-48(42,47-12-3-1-11(2-4-12)35(40)41)44-6-14-18(37)20(39)26(46-14)34-10-32-16-22(34)28-8-30-24(16)50/h1-4,7-10,13-14,17-20,25-26,36-39H,5-6H2,(H,27,29,49)(H,28,30,50) |
| InChIKey | VCLRAXGOEMQELY-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 280.28 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.65 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|