C22H22N5O8P — CID 137279641
[(2R,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl diphenyl phosphate (PubChem CID 137279641) has the molecular formula C22H22N5O8P and a molecular weight of 515.42 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl diphenyl phosphate.
| Compound Name | [(2R,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl diphenyl phosphate |
|---|---|
| PubChem CID | 137279641 |
| Molecular Formula | C22H22N5O8P |
| Molecular Weight | 515.42 g/mol |
| Exact Mass | 515.12 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl diphenyl phosphate |
| SMILES | Nc1nc2c(ncn2[C@@H]2O[C@H](COP(=O)(Oc3ccccc3)Oc3ccccc3)[C@@H](O)[C@H]2O)c(=O)[nH]1 |
| InChI | InChI=1S/C22H22N5O8P/c23-22-25-19-16(20(30)26-22)24-12-27(19)21-18(29)17(28)15(33-21)11-32-36(31,34-13-7-3-1-4-8-13)35-14-9-5-2-6-10-14/h1-10,12,15,17-18,21,28-29H,11H2,(H3,23,25,26,30)/t15-,17-,18-,21-/m1/s1 |
| InChIKey | LAHQPIQKCGEWAE-QTQZEZTPSA-N |
| XLogP | 1.60 |
| TPSA | 184.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.42 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|