C11H15N5O10P2-2 — CID 171157402
[5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-[[hydroxy(oxido)phosphoryl]methyl]phosphinate (PubChem CID 171157402) has the molecular formula C11H15N5O10P2-2 and a molecular weight of 439.21 g/mol. Its IUPAC name is [5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-[[hydroxy(oxido)phosphoryl]methyl]phosphinate.
| Compound Name | [5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-[[hydroxy(oxido)phosphoryl]methyl]phosphinate |
|---|---|
| PubChem CID | 171157402 |
| Molecular Formula | C11H15N5O10P2-2 |
| Molecular Weight | 439.21 g/mol |
| Exact Mass | 439.03 |
| IUPAC Name | [5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-[[hydroxy(oxido)phosphoryl]methyl]phosphinate |
| SMILES | Nc1nc2c(ncn2C2OC(COP(=O)([O-])CP(=O)([O-])O)C(O)C2O)c(=O)[nH]1 |
| InChI | InChI=1S/C11H17N5O10P2/c12-11-14-8-5(9(19)15-11)13-2-16(8)10-7(18)6(17)4(26-10)1-25-28(23,24)3-27(20,21)22/h2,4,6-7,10,17-18H,1,3H2,(H,23,24)(H2,20,21,22)(H3,12,14,15,19)/p-2 |
| InChIKey | OCJWYBKRHNXUME-UHFFFAOYSA-L |
| XLogP | -3.61 |
| TPSA | 249.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.21 |
| LogP ≤ 5 | -3.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|