C18H26NNaO16P+ — CID 23666380
sodium (4-nitrophenyl) [(2R,3S,4S,5S,6S)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl [(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] phosphate (PubChem CID 23666380) has the molecular formula C18H26NNaO16P+ and a molecular weight of 566.36 g/mol. Its IUPAC name is sodium (4-nitrophenyl) [(2R,3S,4S,5S,6S)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl [(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] phosphate.
| Compound Name | sodium (4-nitrophenyl) [(2R,3S,4S,5S,6S)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl [(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] phosphate |
|---|---|
| PubChem CID | 23666380 |
| Molecular Formula | C18H26NNaO16P+ |
| Molecular Weight | 566.36 g/mol |
| Exact Mass | 566.09 |
| IUPAC Name | sodium (4-nitrophenyl) [(2R,3S,4S,5S,6S)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl [(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] phosphate |
| SMILES | O=[N+]([O-])c1ccc(OP(=O)(OC[C@H]2O[C@H](O)[C@@H](O)[C@@H](O)[C@@H]2O)O[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)cc1.[Na+] |
| InChI | InChI=1S/C18H26NO16P.Na/c20-5-9-11(21)14(24)16(26)18(33-9)35-36(30,34-8-3-1-7(2-4-8)19(28)29)31-6-10-12(22)13(23)15(25)17(27)32-10;/h1-4,9-18,20-27H,5-6H2;/q;+1/t9-,10-,11+,12-,13+,14+,15+,16-,17+,18-,36?;/m1./s1 |
| InChIKey | ZBTRVKMQVBEABN-PMOVOOTMSA-N |
| XLogP | -6.28 |
| TPSA | 268.20 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.36 |
| LogP ≤ 5 | -6.28 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|