C12H16NO11P — CID 69137536
[(2R,3S,4S,5S,6S)-3,4,6-trihydroxy-5-(4-nitrophenoxy)oxan-2-yl]methyl dihydrogen phosphate (PubChem CID 69137536) has the molecular formula C12H16NO11P and a molecular weight of 381.23 g/mol. Its IUPAC name is [(2R,3S,4S,5S,6S)-3,4,6-trihydroxy-5-(4-nitrophenoxy)oxan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,3S,4S,5S,6S)-3,4,6-trihydroxy-5-(4-nitrophenoxy)oxan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 69137536 |
| Molecular Formula | C12H16NO11P |
| Molecular Weight | 381.23 g/mol |
| Exact Mass | 381.05 |
| IUPAC Name | [(2R,3S,4S,5S,6S)-3,4,6-trihydroxy-5-(4-nitrophenoxy)oxan-2-yl]methyl dihydrogen phosphate |
| SMILES | O=[N+]([O-])c1ccc(O[C@H]2[C@@H](O)[C@H](O)[C@@H](COP(=O)(O)O)O[C@@H]2O)cc1 |
| InChI | InChI=1S/C12H16NO11P/c14-9-8(5-22-25(19,20)21)24-12(16)11(10(9)15)23-7-3-1-6(2-4-7)13(17)18/h1-4,8-12,14-16H,5H2,(H2,19,20,21)/t8-,9-,10+,11+,12+/m1/s1 |
| InChIKey | ZLXDWHDPNIGSDT-GCHJQGSQSA-N |
| XLogP | -1.11 |
| TPSA | 189.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.23 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|